Tobias1984/Testcase table |  | |
| Trade names | Linospan, Zyvox, Zyvoxam, Zyvoxid |
|---|
| AHFS/Drugs.com | Monograph |
|---|
| MedlinePlus | a602004 |
|---|
| License data |
|
|---|
Pregnancy category | |
|---|
Routes of administration | Intravenous infusion, oral |
|---|
| ATC code | |
|---|
|
| Legal status |
- S4 (Au), POM (UK), ℞-only (U.S.)
|
|---|
|
| Bioavailability | ~100% (oral) |
|---|
| Protein binding | Low (31%) |
|---|
| Metabolism | Hepatic (50–70%, CYP not involved) |
|---|
| Onset of action | 1 hr |
|---|
| Elimination half-life | 4.2–5.4 hours (shorter in children) |
|---|
| Excretion | Nonrenal, renal, and fecal |
|---|
|
(S)-N-({3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide
| | CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| NIAID ChemDB | |
|---|
| PDB ligand | |
|---|
|
| Formula | C16H20FN3O4 |
|---|
| Molar mass | 337.346 g/mol g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
|
InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 YKey:TYZROVQLWOKYKF-ZDUSSCGKSA-N Y
| N Y (what is this?) (verify) | |
Tobias1984/Testcase table |  | |
| Trade names | Linospan, Zyvox, Zyvoxam, Zyvoxid |
|---|
| AHFS/Drugs.com | Monograph |
|---|
| MedlinePlus | a602004 |
|---|
| License data |
|
|---|
Pregnancy category | |
|---|
Routes of administration | Intravenous infusion, oral |
|---|
| ATC code | |
|---|
|
| Legal status |
- S4 (Au), POM (UK), ℞-only (U.S.)
|
|---|
|
| Bioavailability | ~100% (oral) |
|---|
| Protein binding | Low (31%) |
|---|
| Metabolism | Hepatic (50–70%, CYP not involved) |
|---|
| Onset of action | 1 hr |
|---|
| Elimination half-life | 4.2–5.4 hours (shorter in children) |
|---|
| Excretion | Nonrenal, renal, and fecal |
|---|
|
(S)-N-({3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide
| | CAS Number | |
|---|
| PubChem CID | |
|---|
| DrugBank | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| NIAID ChemDB | |
|---|
| PDB ligand | |
|---|
|
| Formula | C16H20FN3O4 |
|---|
| Molar mass | 337.346 g/mol g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
|
InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 YKey:TYZROVQLWOKYKF-ZDUSSCGKSA-N Y
| N Y (what is this?) (verify) | |