8-Mercaptoquinoline

8-Mercaptoquinoline

Names
Preferred IUPAC name Quinoline-8-thiol
Other names 8-Quinolinethiol Mercaptoquinoline Thiooxine
Identifiers
CAS Number	491-33-8
3D model (JSmol)	Interactive image
ChemSpider	86692
PubChem CID	96028
UNII	F77S9F93J4 Y
CompTox Dashboard (EPA)	DTXSID70197678
InChI InChI=1S/C9H7NS/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H Key: MHTSJSRDFXZFHQ-UHFFFAOYSA-N InChI=1/C9H7NS/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H Key: MHTSJSRDFXZFHQ-UHFFFAOYAD
SMILES c1cc2cccnc2c(c1)S
Properties
Chemical formula	C9H8NS
Molar mass	162.23 g·mol−1
Appearance	red dihydrate, blue liquid anhydrous
Melting point	58.5 °C (137.3 °F; 331.6 K)
Boiling point	296 °C (565 °F; 569 K)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

8-Mercaptoquinoline is the organosulfur compound with the formula C₉H₇NSH. It is a derivative of the heterocycle quinoline, substituted in the 8-position with a thiol group. The compound is an analog of 8-hydroxyquinoline, a common chelating agent. In terms of physical properties, this compound crystallizes as a red solid dihydrate but the anhydrous compound is a blue liquid.^[1][2]

8-Mercaptoquinoline functions as a bidentate ligand for many metal ions.^[3]