Anthrols (sometimes called anthranols) are the hydroxylated derivatives of anthracene. For the monohydroxo derivatives, three isomers are possible: 1-anthrol, 2-anthrol, and 9-anthrol. The latter exists as a minor tautomer of 9-anthrone.
More information Name, CAS ...
Monohydroxo isomers
| Name |
CAS |
Melting point |
Structure |
| 1-anthrol, 1-hydroxyanthracene |
610-50-4 |
150 °C | 302 °F |
 |
| 2-anthrol, 2-hydroxyanthracene |
613-14-9 |
166 °C | 331 °F |
 |
| 9-anthrol, 9-hydroxyanthracene[1] |
529-86-2 |
152 °C | 306 °F |
 |
Close
Quick facts Identifiers ...
Anthrol
| Identifiers |
|
|
|
|
|
1869102 |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| EC Number |
|
|
185412 |
| KEGG |
|
|
|
| UNII |
|
1-: InChI=1S/C14H10O/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9,15H Key: MUVQKFGNPGZBII-UHFFFAOYSA-N 2-: InChI=1S/C14H10O/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9,15H Key: BQBWUVWMUXGILF-UHFFFAOYSA-N 9-: InChI=1S/C14H10O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9,15H Key: AUKRYONWZHRJRE-UHFFFAOYSA-N 1,2-: InChI=1S/C14H10O2/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16/h1-8,15-16H Key: UTCOUOISVRSLSH-UHFFFAOYSA-N 1,2,3-: InChI=1S/C14H10O3/c15-12-7-10-5-8-3-1-2-4-9(8)6-11(10)13(16)14(12)17/h1-7,15-17H Key: SLOLMTWBBAFOKJ-UHFFFAOYSA-N
|
1-: C1=CC=C2C=C3C(=CC2=C1)C=CC=C3O 2-: C1=CC=C2C=C3C=C(C=CC3=CC2=C1)O 9-: C1=CC=C2C(=C1)C=C3C=CC=CC3=C2O 1,2-: C1=CC=C2C=C3C(=CC2=C1)C=CC(=C3O)O 1,2,3-: C1=CC=C2C=C3C(=CC2=C1)C=C(C(=C3O)O)O
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
