Aplyzanzine A
From Wikipedia, the free encyclopedia
Aplyzanzine A
 |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C25H33Br4N3O3/c1-31(2)9-6-10-35-24-20(28)11-16(12-21(24)29)7-8-30-25(33)22(32(3)4)15-17-13-18(26)23(34-5)19(27)14-17/h11-14,22H,6-10,15H2,1-5H3,(H,30,33)/t22-/m0/s1 Key: OZOVQXJIZUQCKN-QFIPXVFZSA-N
|
CN(C)CCCOc1c(cc(cc1Br)CCNC(=O)[C@H](Cc2cc(c(c(c2)Br)OC)Br)N(C)C)Br
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Aplyzanzine A is a bio-active isolate of marine sponge.[2]
- ↑ "KNApSAcK Metabolite Information - C00045649". www.knapsackfamily.com.
- ↑ Kottakota, SK; Evangelopoulos, D; Alnimr, A; Bhakta, S; McHugh, TD; Gray, M; Groundwater, PW; Marrs, EC; Perry, JD; Spilling, CD; Harburn, JJ (2012). "Synthesis and biological evaluation of purpurealidin E-derived marine sponge metabolites: aplysamine-2, aplyzanzine A, and suberedamines A and B". J Nat Prod. 75 (6): 1090–101. doi:10.1021/np300102z. PMID 22620987.