Fensulfothion
Chemical compound
From Wikipedia, the free encyclopedia
Fensulfothion is an organophosphorus compound with the formula CH2S(O)C6H4OP(S)(OC2H5)2. It is an insecticide and nematicide that acts by inhibiting the enzyme acetylcholinesterase. Chemically, it is classified as a thiophosphate.[2] It is widely used on corn, onions, rutabagas, pineapple, bananas, sugar cane, sugar beets, pea nuts, etc.
| Names | |
|---|---|
| Preferred IUPAC name
O,O-Diethyl O-[4-(methanesulfinyl)phenyl] phosphorothioate | |
| Identifiers | |
3D model (JSmol) |
|
| ChemSpider | |
| ECHA InfoCard | 100.003.741 |
PubChem CID |
|
| UNII | |
CompTox Dashboard (EPA) |
|
| |
| |
| Properties | |
| C11H17O4PS2 | |
| Molar mass | 308.35 g·mol−1 |
| Appearance | Brown liquid or yellow oil[1] |
| Density | 1.20 g/mL (20°C)[1] |
| 0.2% (25°C) | |
| Hazards | |
| Occupational safety and health (OHS/OSH): | |
Main hazards |
combustible[1] |
| NIOSH (US health exposure limits): | |
PEL (Permissible) |
none[1] |
REL (Recommended) |
TWA 0.1 mg/m3[1] |
IDLH (Immediate danger) |
N.D.[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
Safety
It is highly toxic and listed as an extremely hazardous substance.[3]
