Funicin
From Wikipedia, the free encyclopedia
Funicin
 |
| Names |
| IUPAC name
Ethyl 2-hydroxy-4-(3-hydroxy-5-methylphenoxy)-6-methylbenzoate |
Other names
- 4-Carbethoxydiorcinal
- Ethericin B
|
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C17H18O5/c1-4-21-17(20)16-11(3)7-14(9-15(16)19)22-13-6-10(2)5-12(18)8-13/h5-9,18-19H,4H2,1-3H3 Key: FDRRGHPJYCPGME-UHFFFAOYSA-N
|
CCOC(=O)C1=C(C=C(C=C1C)OC2=CC(=CC(=C2)O)C)O
|
| Properties |
|
C17H18O5 |
| Molar mass |
302.326 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Funicin is an antibiotic which is produced by the fungi Aspergillus funiculosus.[1][2] Funicin has the molecular formula C17H18O5
- ↑ Nakamura, M.; Fukuyama, K.; Tsukihara, T.; Katsube, Y.; Hamasaki, T. (15 February 1983). "Structure of funicin, antimicrobial substance from Aspergillus funiculosus, C17H18O5". Acta Crystallographica Section C Crystal Structure Communications. 39 (2): 268–270. Bibcode:1983AcCrC..39..268N. doi:10.1107/S0108270183004357.
- ↑ Buckingham, John (1987). Dictionary of Organic Compounds. Taylor & Francis. p. 342. ISBN 978-0-412-17050-8.