Hispolon
From Wikipedia, the free encyclopedia
Hispolon
 |
| Names |
| IUPAC name
6-(3,4-Dihydroxyphenyl)-4-hydroxyhexa-3,5-dien-2-one |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
InChI=1S/C12H12O4/c1-8(13)6-10(14)4-2-9-3-5-11(15)12(16)7-9/h2-7,14-16H,1H3 Key: QDVIEIMMEUCFMW-UHFFFAOYSA-N
|
CC(=O)C=C(C=CC1=CC(=C(C=C1)O)O)O
|
| Properties |
|
C12H12O4 |
| Molar mass |
220.224 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Hispolon is a bio-active isolate of Phellinus linteus.[1]
- ↑ Chen, YC; Chang, HY; Deng, JS; Chen, JJ; Huang, SS; Lin, IH; Kuo, WL; Chao, W; Huang, GJ (2013). "Hispolon from Phellinus linteus Induces G0/G1 Cell Cycle Arrest and Apoptosis in NB4 Human Leukaemia Cells". The American Journal of Chinese Medicine. 41 (6): 1439–57. doi:10.1142/S0192415X13500961. PMID 24228611.