Landomycinone
From Wikipedia, the free encyclopedia
Landomycinone
 |
| Names |
| IUPAC name
(6R)-1,6,8,11-Tetrahydroxy-3-methyl-5,6-dihydro-7,12-tetraphenedione |
| Identifiers |
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C19H14O6/c1-7-4-8-6-12(23)16-17(13(8)11(22)5-7)19(25)15-10(21)3-2-9(20)14(15)18(16)24/h2-5,12,20-23H,6H2,1H3/t12-/m1/s1 Key: DMGKSWBAQZKXEJ-GFCCVEGCSA-N InChI=1/C19H14O6/c1-7-4-8-6-12(23)16-17(13(8)11(22)5-7)19(25)15-10(21)3-2-9(20)14(15)18(16)24/h2-5,12,20-23H,6H2,1H3/t12-/m1/s1 Key: DMGKSWBAQZKXEJ-GFCCVEGCBR
|
Cc1cc2c(c(c1)O)C3=C([C@@H](C2)O)C(=O)c4c(ccc(c4C3=O)O)O
|
| Properties |
|
C19H14O6 |
| Molar mass |
338.311 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Landomycinone is the aglycone of the landomycins.[1]
- ↑ Bugaut, Xavier; Guinchard, Xavier; Roulland, Emmanuel (December 3, 2010). "Synthesis of the landomycinone skeleton". The Journal of Organic Chemistry. 75 (23). ACS Publications: 8190–8198. doi:10.1021/jo1018377. PMID 21028772.