Oxalate phosphate
Chemical compound containing oxalate and phosphate anions
From Wikipedia, the free encyclopedia
The oxalate phosphates are chemical compounds containing oxalate and phosphate anions. They are also called oxalatophosphates or phosphate oxalates. Some oxalate-phosphate minerals found in bat guano deposits are known.[1] Oxalate phosphates can form metal organic framework compounds.
(HPO4)-jpmaterabe5f9f1_hr.jpg)
Related compounds include the arsenate oxalates,[2][3] and phosphite oxalates,[4] oxalatomethylphosphonate,[5] and potentially other oxalate phosphonates.
List
| name | chem | mw | crystal system | space group | unit cell Å | volume | density | comment | references |
|---|---|---|---|---|---|---|---|---|---|
| Phoxite | (NH4)2Mg2(C2O4)(PO3OH)2(H2O)4 | monoclinic | P21/c | a=7.2962 b=13.5993 c=7.8334 β=108.271° Z=2 | 738.07 | 1.98 | mineral biaxial(-) α = 1.499, β = 1.541 γ = 1.542; 2V = 16 | [6] | |
| Thebaite-(NH4) | (NH4,K)3Al(C2O4)(PO3OH)2(H2O) | monoclinic | P21/c | a = 11.156, b = 6.234, c = 18.65, β = 102.93°, Z=4 | 1264 | 2.093 | biaxial (–) α = 1.490, β = 1.534, γ = 1.570; 2V = 82.7° | [7] | |
| bis(N-methylpiperazinedi-ium) bis(bis(μ-dihydrogen phosphato)-(oxalato)-scandium) oxalate trihydrate | H2mpip⋅Sc(H2PO4)2(C2O4)·0.5C2O4·1.5H2O | C2 | a=17.1307 b=6.6277 c=16.3543 β=103.336° | [8] | |||||
| Davidbrownite-(NH4) | (NH4), (NH4,K)5(V4+O)2(C2O4)[PO4H]3·[PO4H2]·3H2O | monoclinic | P21/c | a = 10.356, b = 8.923, c = 13.486, β = 92.618°, Z = 2 | 1244.9 | 2.12 | green–blue mineral biaxial (+) α = 1.540, β = 1.550 γ = 1.582; 2V = 58.5 | [1] | |
| (NH4)2[(VO)2(HPO4)2C2O4]·5H2O | [9] | ||||||||
| Li2(VO)2(HPO4)2(C2O4) | [10] | ||||||||
| Li2(VO)2(HPO4)2(C2O4)·6H2O | 535.84 | triclinic | a = 6.4133 b = 9.2173, c = 14.6206 α = 95.016°, β = 91.797°, γ = 107.7622°, and Z = 2 | 818.38 | 2.1743 | [10] | |||
| Na2[(VO)2(HPO4)2C2O4].2H2O | monoclinic | P21 | a = 6.3534, b = 17.1614, c = 6.5632, β = 106.59 | sheet morphology | [9][11] | ||||
| K2[(VO)2(HPO4)2(C2O4)] | 492.05 | triclinic | a=6.316 b=7.489 c=10.861 α=56.8° β=57.99° γ=54.20° | [12] | |||||
| K2[(VO)2(HPO4)2(C2O4)]·4.5H2O | triclinic | P1 | a = 6.3953, b = 9.1451, c = 14.6208, α = 97.269°, β = 91.351° γ = 106.500° Z=2 | [12] | |||||
| K2.5[(VO)2(HPO4)1.5(PO4)0.5(C2O4)] | MOF | [13] | |||||||
| LiK[(VO)2(HPO4)2(C2O4)]·4.5H2O | [13] | ||||||||
| (C2H10N2)[VO(HPO4)]2(C2O4) | 473.96 | triclinic | P1 | a = 6.3595, b = 6.6236, c = 9.224, α = 98.216o, β = 108.128o, γ = 100.672o, Z = 1 | 354.42 | 2.225 | [14] | ||
| guanidine vanadyl hydrogenphosphate oxalate | (CH6N3)2[VO(HPO4)]2(C2O4) | 532.02 | triclinic | P1 | a = 6.3825, b = 7.8877, c = 9.202, α = 66.602o, β = 71.757o, γ = 79.821o, Z = 1 | 403.07 | 2.192 | [14] | |
| catena-(4,4'-Bipyridinium bis(μ3-hydrogen phosphato)-(μ2-oxalato)-dioxo-di-vanadium) | (C10H10N2)[(VO)(HPO4)]2(C2O4) | monoclinic | P21/c | a=9.250 b=6.338 c=16.111, β=98.08° | [15] | ||||
| K2MnII2(H2O)2C2O4(HPO3)2 | oxalophosphite | [16] | |||||||
| TREN = tris(2-aminoethyl)amine) | (H3TREN)[Mn2(HPO4)(C2O4)2.5]·3H2O | triclinic | P1 | a = 8.8385, b = 9.0586, c = 16.020, α = 77.616°, β = 83.359°, γ = 68.251°, and Z = 2. | [17] | ||||
| mpip1-methylpiperazine | (H2mpip)1.5•Mn3(HPO4)(H2PO4)(C2O4)2 | [18] | |||||||
| dap=1,2-diaminopropane | (H2dap)•Mn3(HPO4)(H2PO4)(C2O4)2 | [18] | |||||||
| pa=propylamine | (Hpa)•Mn3(HPO4)(H2PO4)(C2O4)2 | [18] | |||||||
| dmp = 1,4-dimethylpiperazine | (H2dmp)0.5·Mn(H2PO4)(C2O4) | triclinic | P1 | a =5.8528 b =8.1833 c =11.1334, α =103.958° β =93.550° γ =90.572° | [19] | ||||
| TREN = tris(2-aminoethyl)amine) | (H3TREN)[Fe2(HPO4)(C2O4)2.5]·3H2O | triclinic | P1 | a = 8.7776, b = 8.9257, c = 15.884, α = 78.630°, β = 84.018°, and γ = 67.372° Z=2 | [17] | ||||
| 1,3-diaminopropane | [C3H12N2]2[Fe5(C2O4)2(HxPO4)8] | 1367.31 | triclinic | P1 | a=9.7851 b=9.8986 c=10.7420 α =73.790 β = 71.684 γ = 79.300 Z=1 | 942.99 | 2.408 | [20] | |
| Na2Fe(C2O4)(HPO4) | monoclinic | P21/c | a=6.4728, b=20.210, c=10.4712 β=90.745 | 1369.7 | orange | [21] | |||
| K2Fe(C2O4)(HPO4)(OH2) · H2O | 354.08 | orthorhombic | Pbca | a=11.880 b=10.384 c=15.337 Z=8 | 1891.9 | 2.486 | yellow | [22] | |
| [NH3(CH2)3NH3][Zn6(PO4)4(C2O4)] | 456.12 | triclinic | P1 | a =5.0030 b=8.5434 c=12.4336 α=92.99 β=97.138 γ = 91.465 Z=2 | 526.33 | 2.878 | [23] | ||
| MIL-90 pentagallium sesquitrimethylenediamine difluoride dihydroxy oxalate tetraphosphate | Ga5(PO4)4(C2O4)F2(OH)2·1.5N2C3H12 | triclinic | P1 | a = 8.1217, b = 8.9601, c = 10.4611, α = 111.930°, β = 103.655°, γ = 101.903° | 648.59 | [24] | |||
| NTHU-6 | 2(C13H16N2) Ga10 8(PO4)(HPO4)4(OH)2(C2O4).3(H2O) | 2251.61 | monoclinic | C2/m | a=23.048 b=24.649 c=17.081 β = 132.192 Z=4 | 7189.8 | 2.080 | yellow | [25] |
| 1,3-diaminopropane | [Ga2(PO4)2(H2O)(C2O4)0.5](C3N2H12)0.5(H2O) | [26] | |||||||
| ethylene diamine | [Ga2(PO4)2(C2O4)0.5](C2N2H10)0.5(H2O) | [26] | |||||||
| 1,3-diaminopropane | [Ga2(PO4)2(C2O4)0.5](C3N2H12)0.5 | [26] | |||||||
| diethylene triamine | [Ga2(PO4)2(H2PO4)0.5(C2O4)0.5](C4N3H16)0.5 (H2O)1.5 | [26] | |||||||
| diethylene triamine | [Ga2.5(PO4)2.5(H2O)1.5(C2O4)0.5](C4N3H15)0.5 | [26] | |||||||
| dmpip = 2,6-dimethyl-piperazine
catena-(bis(2,6-dimethylpiperazine-1,4-di-ium) bis(μ-hydrogen phosphato)-bis(μ-phosphato)-(μ-oxalato)-bis(hydrogen phosphato)-tetra-gallium dihydrate |
[H2dmpip][Ga2(HPO4)2(PO4)(C2O4)0.5]·H2O | monoclinic | P21/c | a 8.904 b 28.036 c 8.173, β =100.74° | [27] | ||||
| catena-(2-(3-ammoniopropyl)propane-1,3-diammonium bis(μ4-phosphato)-bis(μ3-phosphato)-(μ2-oxalato)-(μ2-monohydrogen phosphato)-tetra-gallium dihydrate) | [C6N3H19][Ga4(C2O4)(PO4)4(H2PO4)]·2H2O | monoclinic | C2/c | a =20.355 b =15.649 c =9.0517 β =105.781° | [28] | ||||
| Sr2(H2PO4)2(C2O4) | monoclinic | P21/c | a=6.8921 b=8.8733
c=8.6231 β=99.354° Z=2 |
520.34 | 2.918 | birefringence 0.107@550 nm; band gap 4.84 eV | [29] | ||
| Piperazinediium bis(μ2-oxalato-O,O',O'',O''')-bis(μ2-hydrogen phosphato-O,O')-diaqua-di-indium dihydrate | [C4N2H12]0.5In(HPO4)(C2O4).H2O | monoclinic | P21/c | a =6.4726 b =11.080 c =14.311, β =100.316° | [30] | ||||
| Piperazinium bis(μ3-monhydrogenphosphato)-(μ2-monohydrogenphosphato)-(μ2-oxalato)-di-indium monohydrate | [C4H12N2][In2(C2O4)(HPO4)3]·H2O | monoclinic | P21 | a =6.5052 b =17.5005 c =8.1811 β =107.656 | [31] | ||||
| dmp = 1,4-dimethylpiperazine
bis(1,4-dimethylpiperazine-1,4-diium) bis(μ-oxalato)-tetrakis(μ-dihydrogen phosphato)-tetrakis(μ-hydrogen phosphato)-tetra-indium(iii) dihydrate |
H2dmp·In2(HPO4)2(H2PO4)2(C2O4)·H2O | a 7.9684 b 11.9582 c 12.5204, α 89.946° β 84.035° γ 87.287° | [19] | ||||||
| dmapa = 3-(dimethylamino)-1-propylamine | H2dmapa·In2(HPO4)2(H2PO4)2(C2O4)·H2O | a 7.8398 b 12.0428 c 12.4877, α 90.013° β 96.335° γ 92.640° | [19] | ||||||
| Cs2Fe(C2O4)0.5(HPO4)2 | [32] | ||||||||
| CsFe(C2O4)0.5(H2PO4)(HPO4) | [32] | ||||||||
| APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Er3(C2O4)5.5(H2PO4)2]·5H2O | [33] | |||||||
| APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Tm3(C2O4)5.5(H2PO4)2]·5H2O | [33] | |||||||
| APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Yb3(C2O4)5.5(H2PO4)2]·5H2O | [33] | |||||||
| APPIP = 1,4-bis(3-aminopropyl)piperazine | (H4APPIP)[Lu3(C2O4)5.5(H2PO4)2]·5H2O | [33] | |||||||
| K4[Th(HPO4)2(C2O4)2(H2O)2]•4Н2O | [34] | ||||||||
| Pb2(H2PO4)2(C2O4) | a=7.0302 b=9.0497
c=8.5316 β=100.618° Z=2 |
533.50 | 4.335 | birefringence 0.129@550 nm; band gap 4.04 eV | [29] | ||||
| Plutonium(IV) oxalatophosphate | ? | [35] | |||||||