Peyonine
From Wikipedia, the free encyclopedia
Peyonine
 |
| Names |
Systematic IUPAC name
1-[2-(3,4,5-Trimethoxyphenyl)ethyl]-1H-pyrrole-2-carboxylic acid |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C16H19NO5/c1-20-13-9-11(10-14(21-2)15(13)22-3)6-8-17-7-4-5-12(17)16(18)19/h4-5,7,9-10H,6,8H2,1-3H3,(H,18,19) Key: DDYNENGLSGKEPO-UHFFFAOYSA-N InChI=1/C16H19NO5/c1-20-13-9-11(10-14(21-2)15(13)22-3)6-8-17-7-4-5-12(17)16(18)19/h4-5,7,9-10H,6,8H2,1-3H3,(H,18,19) Key: DDYNENGLSGKEPO-UHFFFAOYAP
|
COc1cc(cc(c1OC)OC)CCn2cccc2C(=O)O
|
| Properties |
|
C16H19NO5 |
| Molar mass |
305.326 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Peyonine is a beta-phenethylpyrrole made by Lophophora.[1]
- ↑ Kapadia GJ, Highet RJ (January 1968). "Peyote alkaloids. IV. Structure of peyonine, novel beta-phenethylpyrrole from Lophophora williamsii". Journal of Pharmaceutical Sciences. 57 (1): 191–2. doi:10.1002/jps.2600570146. PMID 5652132.