Pregomisin
From Wikipedia, the free encyclopedia
Pregomisin
 |
| Names |
| IUPAC name
(8R,8′S)-4,4′,5,5′-Tetramethoxylignane-3,3′-diol |
Systematic IUPAC name
3,3′-[(2R,3S)-2,3-Dimethylbutane-1,4-diyl]bis(5,6-dimethoxyphenol) |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
InChI=1S/C22H30O6/c1-13(7-15-9-17(23)21(27-5)19(11-15)25-3)14(2)8-16-10-18(24)22(28-6)20(12-16)26-4/h9-14,23-24H,7-8H2,1-6H3/t13-,14+ Key: RLRKIWSBYUZHIJ-OKILXGFUSA-N InChI=1/C22H30O6/c1-13(7-15-9-17(23)21(27-5)19(11-15)25-3)14(2)8-16-10-18(24)22(28-6)20(12-16)26-4/h9-14,23-24H,7-8H2,1-6H3/t13-,14+ Key: RLRKIWSBYUZHIJ-OKILXGFUBC
|
C[C@H](Cc1cc(c(c(c1)OC)OC)O)[C@@H](C)Cc2cc(c(c(c2)OC)OC)O
|
| Properties |
|
C22H30O6 |
| Molar mass |
390.476 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Pregomisin is a chemical compound isolated from Schisandra chinensis.[1]
- ↑ Lee, Im Seon; Jung, Keun Young; Oh, Sel Ryang; Kim, Dong Seon; Kim, Jung Hee; Lee, Jung Joon; Lee, Hyeong-Kyu; Lee, Seung-Ho; Kim, Eun-Hee; Cheong, Chaejoon (1997). "Platelet-activating factor antagonistic activity and 13C NMR assignment of pregomisin and chamigrenal from Schisandra chinensis". Archives of Pharmacal Research. 20 (6): 633–636. doi:10.1007/BF02975223. PMID 18982271. S2CID 36393901.