Roymillerite
From Wikipedia, the free encyclopedia
| Roymillerite | |
|---|---|
| General | |
| Category | Minerals |
| Formula | Pb24Mg9(Si10O28)(CO3)10(BO3)(SiO4)(OH)13O5 |
| IMA symbol | Roy[1] |
| Crystal system | triclinic crystal system |
| Space group | P1 |
| Identification | |
| Color | colorless, slightly pink |
| Luster | vitreous |
Roymillerite[2] is a solid colorless transparent crystalline mineral. It has a non-trivial crystal structure.
Roymillerite was found in the Otavi Valley (Namibia). Named after geologist and mineralogist Roy McG. Miller.[3]
The sample is stored in the Swedish Museum of Natural History in Stockholm under the number 20080176.[4]