Sterpuric acid

Sterpuric acid

Names
Preferred IUPAC name (2aS,3aR,5S,7aR)-7a-Hydroxy-2a,5,7-trimethyl-2,2a,3,3a,4,5,6,7a-octahydro-1H-cyclobuta[f]indene-5-carboxylic acid
Identifiers
CAS Number	79367-59-2 N[1]
3D model (JSmol)	Interactive image
ChEMBL	ChEMBL2071322
ChemSpider	22899163
PubChem CID	14108443
CompTox Dashboard (EPA)	DTXSID701045357
InChI InChI=1S/C15H22O3/c1-9-11-8-13(2,12(16)17)6-10(11)7-14(3)4-5-15(9,14)18/h10,18H,4-8H2,1-3H3,(H,16,17)/t10-,13-,14-,15-/m0/s1 Key: PQUVTIVCCBHWFH-HJPIBITLSA-N
SMILES OC12C(=C3CC(CC3CC1(CC2)C)(C(=O)O)C)C
Properties
Chemical formula	C15H22O3
Molar mass	250.338 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Sterpuric acid is a phytotoxic metabolite derived from the fungus Stereum purpureum,^[2] from which it derives its name. This fungus causes silver-leaf disease of fruit trees.

Sterpuric acid disrupts plant cell membranes, leading to necrosis and the characteristic silvering of leaves^[3]. The fungus also produces other phytotoxic compounds, such as sterpurene, which contribute to its pathogenicity.^[4]