Truxinic acid

Truxinic acid

Names
IUPAC name 7,7′-Cyclolignane-9,9′-dioic acid
Systematic IUPAC name 3,4-Diphenylcyclohexane-1,2-dicarboxylic acid
Identifiers
CAS Number	528-35-8 β: 528-34-7
3D model (JSmol)	Interactive image μ: Interactive image
ChemSpider	233812 β: 8119639 μ: 103883278
PubChem CID	266036
CompTox Dashboard (EPA)	DTXSID60963283
InChI InChI=1S/C18H16O4/c19-17(20)15-13(11-7-3-1-4-8-11)14(16(15)18(21)22)12-9-5-2-6-10-12/h1-10,13-16H,(H,19,20)(H,21,22) Key: QVNDSQQNODQYJM-UHFFFAOYSA-N μ: InChI=1S/C18H16O4/c19-17(20)15-13(11-7-3-1-4-8-11)14(16(15)18(21)22)12-9-5-2-6-10-12/h1-10,13-16H,(H,19,20)(H,21,22)/t13-,14-,15-,16-/m0/s1 Key: QVNDSQQNODQYJM-VGWMRTNUSA-N
SMILES c1ccc(cc1)C2C(C(C2C(=O)O)C(=O)O)c3ccccc3 μ: O=C(O)[C@@H]1[C@@H](C(=O)O)[C@@H](c2ccccc2)[C@@H]1c1ccccc1
Properties
Chemical formula	C18H16O4
Molar mass	296.322 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Truxinic acids are any of several stereoisomeric cyclic dicarboxylic acids with the formula (C₆H₅)₂C₄H₄(COOH)₂, found in various plants.^[1][2] They are obtained by a photochemical cycloaddition from cinnamic acid,^[3] where the two trans alkenes react head-to-head.