Cadmium oxalate

Cadmium oxalate

Identifiers
CAS Number	814-88-0 Y
3D model (JSmol)	Interactive image
ChemSpider	11409843
EC Number	212-408-8
PubChem CID	3083647
CompTox Dashboard (EPA)	DTXSID30231082
InChI InChI=1S/C2H2O4.Cd/c3-1(4)2(5)6;/h(H,3,4)(H,5,6); Key: OPPBPDNPEOPGLG-UHFFFAOYSA-N
SMILES C(=O)(C(=O)O)O.[Cd]
Properties
Chemical formula	C2CdO4
Molar mass	200.432 g·mol−1
Density	3.32 g·cm−3 (anhydrous)[1]
Melting point	340 °C (613 K) (decomposes, anhydrous) 180 °C (453 K) (decomposes, dihydrate)[1]
Solubility in water	0.003 g (18 °C, trihydrate)[1]
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Cadmium oxalate is an inorganic compound with the chemical formula CdC₂O₄. It can be produced by reacting potassium oxalate and cadmium nitrate.^[2] Its thermal decomposition in air produces cadmium oxide,^[3] while metallic cadmium will be formed instead under vacuum.^[4] It reacts with chalcogens in ethylenediamine to form the corresponding cadmium chalcogenide:^[5]

CdC₂O₄ + E → CdE + 2 CO₂↑ (E = S, Se, Te)