Grifolin
From Wikipedia, the free encyclopedia
Grifolin
 |
| Names |
Preferred IUPAC name
5-Methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]benzene-1,3-diol |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C22H32O2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-21(23)14-19(5)15-22(20)24/h8,10,12,14-15,23-24H,6-7,9,11,13H2,1-5H3/b17-10+,18-12+ Key: PZHNKNRPGLTZPO-VZRGJMDUSA-N InChI=1/C22H32O2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-21(23)14-19(5)15-22(20)24/h8,10,12,14-15,23-24H,6-7,9,11,13H2,1-5H3/b17-10+,18-12+ Key: PZHNKNRPGLTZPO-VZRGJMDUBE
|
CC1=CC(=C(C(=C1)O)C/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O
|
| Properties |
|
C22H32O2 |
| Molar mass |
328.496 g·mol−1 |
| Melting point |
41 °C (106 °F; 314 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Grifolin is an isolate of the mushroom Albatrellus confluens which upregulates DAPK1 in vitro.[1]
- ↑ Luo, XJ; Li, LL; Deng, QP; Yu, XF; Yang, LF; Luo, FJ; Xiao, LB; Chen, XY; Ye, M; Liu, JK; Cao, Y (2011). "Grifolin, a potent antitumour natural product upregulates death-associated protein kinase 1 DAPK1 via p53 in nasopharyngeal carcinoma cells". European Journal of Cancer. 47 (2): 316–25. doi:10.1016/j.ejca.2010.09.021. PMID 20943371.