Trisulfuryl chloride

Trisulfuryl chloride
Names
	Preferred IUPAC name Bis(chlorosulfonyl) sulfate
	Other names Trisulfuryl dichloride, sulfuric bischloridosulfuric acid dianhydride, [(chlorosulfonyl)oxy]sulfonyl sulfurochloridate
Identifiers
CAS Number	13637-77-9;
3D model (JSmol)	Interactive image;
PubChem CID	101282780;
	InChI InChI=1S/Cl2O8S3/c1-11(3,4)9-13(7,8)10-12(2,5)6 Key: QRCGDDSWWPZGAR-UHFFFAOYSA-N;
	SMILES O=S(=O)(OS(=O)(=O)Cl)OS(=O)(=O)Cl;
Properties
Chemical formula	Cl2O8S3
Molar mass	295.07 g·mol−1
Appearance	liquid
Solubility in water	reacts with water
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Trisulfuryl chloride is an inorganic compound of chlorine, oxygen, and sulfur with the chemical formula S₃O₈Cl₂.^[1]

v t e Chlorine compounds
Chlorides and acids	HCl HClO HClO₂ HClO₃ HClO₄ HSO₃Cl BaClF BCl₃ CCl₄ SiCl₄ TiCl₄ C₃H₅Cl
Chlorine fluorides	ClF ClF₃ ClF₅
Chlorine oxides	ClO ClO₂ Cl₂O Cl₂O₂ Cl₂O₃ Cl₂O₄ Cl₂O₅ Cl₂O₆ Cl₂O₇ ClO₄
Chlorine oxyfluorides	ClOF ClOF₃ ClO₂F ClOF₅ (predicted) ClO₂F₃ ClO₃F
Chlorine(I) derivatives	ClNO₃ ClSO₃F ClN₃ Cl₃N

Properties